| Record Information |
|---|
| Version | 1.0 |
|---|
| Creation Date | 2016-08-01 08:03:30 UTC |
|---|
| Update Date | 2016-08-02 20:15:41 UTC |
|---|
| Lmdb | LMDB00873 |
|---|
| Secondary Accession Numbers | None |
|---|
| Metabolite Identification |
|---|
| Common Name | Dihomo-alpha-linolenate (20:3(n-3)) |
|---|
| Description | Dihomo-alpha-linolenic acid, also known as 11,14,17-eicosatrienoic acid or (Z,Z,Z)-11,14,17-eicosatrienoate, belongs to the class of organic compounds known as long-chain fatty acids. These are fatty acids with an aliphatic tail that contains between 13 and 21 carbon atoms. Dihomo-alpha-linolenic acid is a very hydrophobic molecule, practically insoluble (in water), and relatively neutral. |
|---|
| Structure | |
|---|
| Synonyms | | Value | Source |
|---|
| (11Z,14Z,17Z)-Eicosa-11,14,17-trienoic acid | ChEBI | | (11Z,14Z,17Z)-Icosa-11,14,17-trienoic acid | ChEBI | | (Z,Z,Z)-11,14,17-Eicosatrienoic acid | ChEBI | | 11,14,17-Eicosatrienoic acid | ChEBI | | 11,14,17-Icosatrienoic acid | ChEBI | | 11C,14C,17C-Eicosatrienoic acid | ChEBI | | 11C,14C,17C-Eicosatriensaeure | ChEBI | | 20:3, N-3,6,9 all-cis | ChEBI | | all-cis-11,14,17-Eicosatrienoic acid | ChEBI | | all-cis-Eicosa-11,14,17-trienoic acid | ChEBI | | all-cis-Eicosa-11,14,17-triensaeure | ChEBI | | C20:3, N-3,6,9 all-cis | ChEBI | | cis,cis,cis-11,14,17-Eicosatrienoic acid | ChEBI | | Eicosa-11Z,14Z,17Z-trienoic acid | ChEBI | | Eicosatrienoic acid | ChEBI | | ETA | ChEBI | | ETE | ChEBI | | (11Z,14Z,17Z)-Eicosa-11,14,17-trienoate | Generator | | (11Z,14Z,17Z)-Icosa-11,14,17-trienoate | Generator | | (Z,Z,Z)-11,14,17-Eicosatrienoate | Generator | | 11,14,17-Eicosatrienoate | Generator | | 11,14,17-Icosatrienoate | Generator | | 11C,14C,17C-Eicosatrienoate | Generator | | all-cis-11,14,17-Eicosatrienoate | Generator | | all-cis-Eicosa-11,14,17-trienoate | Generator | | cis,cis,cis-11,14,17-Eicosatrienoate | Generator | | Eicosa-11Z,14Z,17Z-trienoate | Generator | | Eicosatrienoate | Generator | | Dihomo-a-linolenate | Generator | | Dihomo-a-linolenic acid | Generator | | Dihomo-alpha-linolenate | Generator | | Dihomo-α-linolenate | Generator | | Dihomo-α-linolenic acid | Generator | | Dihomolinolenate | HMDB | | 11,14,17-Eicosatrienoic acid, (Z,Z,Z)-isomer | HMDB | | Bishomo-a-linolenate | HMDB | | Bishomo-a-linolenic acid | HMDB | | Bishomo-alpha-linolenate | HMDB | | Bishomo-α-linolenate | HMDB | | Bishomo-α-linolenic acid | HMDB | | Bishomo-alpha-linolenic acid | HMDB | | Dihomo-linolenate | HMDB | | Dihomo-linolenic acid | HMDB | | Dihomolinolenic acid | HMDB | | FA(20:3(11Z,14Z,17Z)) | HMDB | | FA(20:3n3) | HMDB | | Homo-alpha-linolenic acid | HMDB | | Homo-α-linolenic acid | HMDB | | Dihomo-alpha-linolenic acid | HMDB |
|
|---|
| Chemical Formula | C20H34O2 |
|---|
| Average Molecular Weight | 306.4828 |
|---|
| Monoisotopic Molecular Weight | 306.255880332 |
|---|
| IUPAC Name | (11Z,14Z,17Z)-icosa-11,14,17-trienoic acid |
|---|
| Traditional Name | eicosatrienoic acid |
|---|
| CAS Registry Number | Not Available |
|---|
| SMILES | CC\C=C/C\C=C/C\C=C/CCCCCCCCCC(O)=O |
|---|
| InChI Identifier | InChI=1S/C20H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h3-4,6-7,9-10H,2,5,8,11-19H2,1H3,(H,21,22)/b4-3-,7-6-,10-9- |
|---|
| InChI Key | AHANXAKGNAKFSK-PDBXOOCHSA-N |
|---|
| Chemical Taxonomy |
|---|
| Description | belongs to the class of organic compounds known as long-chain fatty acids. These are fatty acids with an aliphatic tail that contains between 13 and 21 carbon atoms. |
|---|
| Kingdom | Organic compounds |
|---|
| Super Class | Lipids and lipid-like molecules |
|---|
| Class | Fatty Acyls |
|---|
| Sub Class | Fatty acids and conjugates |
|---|
| Direct Parent | Long-chain fatty acids |
|---|
| Alternative Parents | |
|---|
| Substituents | - Long-chain fatty acid
- Unsaturated fatty acid
- Straight chain fatty acid
- Monocarboxylic acid or derivatives
- Carboxylic acid
- Carboxylic acid derivative
- Organic oxygen compound
- Organic oxide
- Hydrocarbon derivative
- Organooxygen compound
- Carbonyl group
- Aliphatic acyclic compound
|
|---|
| Molecular Framework | Aliphatic acyclic compounds |
|---|
| External Descriptors | |
|---|
| Ontology |
|---|
| Status | Detected but not Quantified |
|---|
| Origin | Not Available |
|---|
| Biofunction | Not Available |
|---|
| Application | Not Available |
|---|
| Cellular locations | Not Available |
|---|
| Physical Properties |
|---|
| State | Not Available |
|---|
| Experimental Properties | | Property | Value | Reference |
|---|
| Melting Point | Not Available | Not Available | | Boiling Point | Not Available | Not Available | | Water Solubility | Not Available | Not Available | | LogP | Not Available | Not Available |
|
|---|
| Predicted Properties | |
|---|
| Spectra |
|---|
| Spectra | | Spectrum Type | Description | Splash Key | View |
|---|
| Predicted GC-MS | Predicted GC-MS Spectrum - GC-MS (Non-derivatized) - 70eV, Positive | splash10-0007-4960000000-ee31f077045fbc10d0c6 | Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - GC-MS (1 TMS) - 70eV, Positive | splash10-022a-8972000000-11b27d7266369b9ebc18 | Spectrum | | Predicted GC-MS | Predicted GC-MS Spectrum - GC-MS (Non-derivatized) - 70eV, Positive | Not Available | Spectrum | | LC-MS/MS | LC-MS/MS Spectrum - LC-ESI-IT , negative | splash10-03dr-0090000000-d8dffe611cf00f7d9e6d | Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - 10V, Positive | splash10-0a4r-1196000000-89a04280ae844b3d1c1e | Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - 20V, Positive | splash10-08g1-5591000000-d0a16956780551b95178 | Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - 40V, Positive | splash10-052g-8950000000-64dfe5d75f4f453c6c31 | Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - 10V, Negative | splash10-0a4i-0029000000-d10c7c1b109440c21136 | Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - 20V, Negative | splash10-0a4i-2089000000-0abcc3d67afb5981b6d4 | Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - 40V, Negative | splash10-0a4i-9130000000-fda7effe116a88cc975f | Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - 10V, Positive | splash10-0a4r-4596000000-995657b9029281236c8e | Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - 20V, Positive | splash10-0a5a-9820000000-87f7e85d00d036dc52d2 | Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - 40V, Positive | splash10-05po-9200000000-eea6b43bb6e346821f50 | Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - 10V, Negative | splash10-0a4i-0019000000-a547ddaba8c204ad4b7f | Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - 20V, Negative | splash10-0a4r-1069000000-c4949e5e0cfdc4b33b86 | Spectrum | | Predicted LC-MS/MS | Predicted LC-MS/MS Spectrum - 40V, Negative | splash10-0006-9210000000-30310e4351623257055d | Spectrum |
|
|---|